CAS 2771010-41-2 appears in our catalog under these names: (R)-1-(4-Bromophenyl)-2,2,2-trifluoro-N-methylethan-1-amine hydrochloride, 98%, (R)-1-(4-Bromophenyl)-2,2,2-trifluoro-N-methylethan-1-amine hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 10g, 25g.
(1R)-1-(4-bromophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride (CAS 2771010-41-2) is a chemical compound with the molecular formula C9H10BrClF3N and a molecular weight of 304.53 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride. InChIKey: JTYAXTIIXALPCC-DDWIOCJRSA-N.
| Molecular formula | C9H10BrClF3N |
|---|---|
| Molecular weight | 304.53 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride |
| InChIKey | JTYAXTIIXALPCC-DDWIOCJRSA-N |
| SMILES | CN[C@H](C1=CC=C(C=C1)Br)C(F)(F)F.Cl |
Computed by PubChem (NCBI)