Products 220458-89-9

CAS 220458-89-9 is the registry number for 2-Methylmercapto-4-oxo-6-aminopyrimidine monohydrate. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g, 100g, 250g.

Structural formula: {0} (CAS {1})

4-amino-2-methylsulfanyl-1H-pyrimidin-6-one;hydrate (CAS 220458-89-9) is a chemical compound with the molecular formula C5H9N3O2S and a molecular weight of 175.21 g/mol. IUPAC name: 4-amino-2-methylsulfanyl-1H-pyrimidin-6-one;hydrate. InChIKey: MQMZYVAVSAPANK-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9N3O2S
Molecular weight175.21 g/mol
IUPAC name4-amino-2-methylsulfanyl-1H-pyrimidin-6-one;hydrate
InChIKeyMQMZYVAVSAPANK-UHFFFAOYSA-N
SMILESCSC1=NC(=CC(=O)N1)N.O

Computed by PubChem (NCBI)