CAS 2204863-06-7 appears in our catalog under these names: Palbociclib Impurity 2, Desoxo-palbociclib, >95% (HPLC), Desoxo-palbociclib, 8-Cyclopentyl-5-methyl-2-((5-(piperazin-1-yl)pyridin-2-yl)amino)-6-vinylpyrido[2,3-d]pyrimidin-7(8H)-one, 95%, 95%, Palbociclib impurity 2, 95.12%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 10 mg, 5 mg, Get quote.
8-cyclopentyl-6-ethenyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one (CAS 2204863-06-7) is a chemical compound with the molecular formula C24H29N7O and a molecular weight of 431.5 g/mol. IUPAC name: 8-cyclopentyl-6-ethenyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one. InChIKey: BAMRZESJXFABIT-UHFFFAOYSA-N.
| Molecular formula | C24H29N7O |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | 8-cyclopentyl-6-ethenyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | BAMRZESJXFABIT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C=C |
Computed by PubChem (NCBI)