Products 294646-77-8
CAS 294646-77-8 appears in our catalog under these names: CR8, (R)-Isomer, (R)-CR8/ 98.41% (existing batch purity), (R)–CR8, (R)-CR8, 98.00%, (R)-CR8 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 0,5g.
(2R)-2-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol (CAS 294646-77-8) is a chemical compound with the molecular formula C24H29N7O and a molecular weight of 431.5 g/mol. IUPAC name: (2R)-2-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol. InChIKey: HOCBJBNQIQQQGT-LJQANCHMSA-N.
| Molecular formula | C24H29N7O |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2R)-2-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol |
| InChIKey | HOCBJBNQIQQQGT-LJQANCHMSA-N |
| SMILES | CC[C@H](CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NCC3=CC=C(C=C3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)