Products 2205018-06-8
CAS 2205018-06-8 is the registry number for Clonostachydiol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
(3Z,5R,6S,9Z,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione (CAS 2205018-06-8) is a chemical compound with the molecular formula C14H20O6 and a molecular weight of 284.30 g/mol. IUPAC name: (3Z,5R,6S,9Z,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione. InChIKey: SSVNIYICRYPPEB-GSVQBQKSSA-N.
| Molecular formula | C14H20O6 |
|---|---|
| Molecular weight | 284.30 g/mol |
| IUPAC name | (3Z,5R,6S,9Z,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione |
| InChIKey | SSVNIYICRYPPEB-GSVQBQKSSA-N |
| SMILES | C[C@H]1CC[C@@H](/C=C\C(=O)O[C@H]([C@@H](/C=C\C(=O)O1)O)C)O |
Computed by PubChem (NCBI)