Products 21142-67-6
CAS 21142-67-6 is the registry number for Colletodiol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, Get quote.
(3E,6R,9E,11R,12R,14R)-11,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione (CAS 21142-67-6) is a chemical compound with the molecular formula C14H20O6 and a molecular weight of 284.30 g/mol. IUPAC name: (3E,6R,9E,11R,12R,14R)-11,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione. InChIKey: SHQHOHRUGBYJBS-RSNJVVJKSA-N.
| Molecular formula | C14H20O6 |
|---|---|
| Molecular weight | 284.30 g/mol |
| IUPAC name | (3E,6R,9E,11R,12R,14R)-11,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione |
| InChIKey | SHQHOHRUGBYJBS-RSNJVVJKSA-N |
| SMILES | C[C@@H]1C/C=C/C(=O)O[C@@H](C[C@H]([C@@H](/C=C/C(=O)O1)O)O)C |
Computed by PubChem (NCBI)