Products 152204-32-5
CAS 152204-32-5 appears in our catalog under these names: Phomaligol A, Phomaligol A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
[(1R,5R)-5-hydroxy-4-methoxy-1,5-dimethyl-2,6-dioxocyclohex-3-en-1-yl] (2S)-2-methylbutanoate (CAS 152204-32-5) is a chemical compound with the molecular formula C14H20O6 and a molecular weight of 284.30 g/mol. IUPAC name: [(1R,5R)-5-hydroxy-4-methoxy-1,5-dimethyl-2,6-dioxocyclohex-3-en-1-yl] (2S)-2-methylbutanoate. InChIKey: DWJRXSZPSOQYDZ-MCCGJVOXSA-N.
| Molecular formula | C14H20O6 |
|---|---|
| Molecular weight | 284.30 g/mol |
| IUPAC name | [(1R,5R)-5-hydroxy-4-methoxy-1,5-dimethyl-2,6-dioxocyclohex-3-en-1-yl] (2S)-2-methylbutanoate |
| InChIKey | DWJRXSZPSOQYDZ-MCCGJVOXSA-N |
| SMILES | CC[C@H](C)C(=O)O[C@@]1(C(=O)C=C([C@@](C1=O)(C)O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Phomaligol A, orb1680909