Products 22052-84-2

CAS 22052-84-2 is the registry number for Heptafluoroisopropyl methyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,1,1,2,3,3,3-heptafluoro-2-methoxypropane (CAS 22052-84-2) is a chemical compound with the molecular formula C4H3F7O and a molecular weight of 200.05 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoro-2-methoxypropane. InChIKey: HRXXERHTOVVTQF-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3F7O
Molecular weight200.05 g/mol
IUPAC name1,1,1,2,3,3,3-heptafluoro-2-methoxypropane
InChIKeyHRXXERHTOVVTQF-UHFFFAOYSA-N
SMILESCOC(C(F)(F)F)(C(F)(F)F)F

Computed by PubChem (NCBI)