CAS 375-01-9 appears in our catalog under these names: 2,2,3,3,4,4,4-Heptafluoro-1-butanol, 95%, 1H,1H-Perfluorobutanol, 2,2,3,3,4,4,4–Heptafluoro–1–butanol, 2,2,3,3,4,4,4-Heptafluoro-1-butanol, 98% , 2,2,3,3,4,4,4-Heptafluoro-1-butanol, >98.0%(GC). Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 1g, 100mg, 100g, 10g, 50g, 250g.
2,2,3,3,4,4,4-heptafluorobutan-1-ol (CAS 375-01-9) is a chemical compound with the molecular formula C4H3F7O and a molecular weight of 200.05 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluorobutan-1-ol. InChIKey: WXJFKAZDSQLPBX-UHFFFAOYSA-N.
| Molecular formula | C4H3F7O |
|---|---|
| Molecular weight | 200.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| InChIKey | WXJFKAZDSQLPBX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)