Products 220621-22-7
CAS 220621-22-7 appears in our catalog under these names: 5-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)-5-oxopentanoic acid, 99% GC（mixture）, 99% GC（mixture）, L-Monomenthyl glutarate, (L)-Monomenthane-3-yl carbonate, 99% GC（mixture）. Offered by: Chemat, MedChemExpress, Ambeed. Available pack sizes: 5g, 25g, 100g, 100 g, 25 g, 50 g, 10 g, 5 g.
5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxopentanoic acid (CAS 220621-22-7) is a chemical compound with the molecular formula C15H26O4 and a molecular weight of 270.36 g/mol. IUPAC name: 5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxopentanoic acid. InChIKey: CTMTYSVTTGVYAW-FRRDWIJNSA-N.
| Molecular formula | C15H26O4 |
|---|---|
| Molecular weight | 270.36 g/mol |
| IUPAC name | 5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxopentanoic acid |
| InChIKey | CTMTYSVTTGVYAW-FRRDWIJNSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCCC(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
l-monomenthyl glutarate, (L)-Monomenthane-3-yl carbonate, 5-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)-5-oxopentanoic acid, Monomenthyl glutarate, (-)-, FEMA No. 4006, L-Monomenthyl glutarate [FHFI], Pentanedioic acid, 1-((1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl) ester, Pentanedioic acid, mono((1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl) ester, 5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxopentanoic acid, L-menthylglutaric acid