Products 45233-65-6

CAS 45233-65-6 is the registry number for 1,4-Dipentyl 2-methylenebutanedioate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Dipentyl 2-methylidenebutanedioate (CAS 45233-65-6) is a chemical compound with the molecular formula C15H26O4 and a molecular weight of 270.36 g/mol. IUPAC name: dipentyl 2-methylidenebutanedioate. InChIKey: NJCKCUVRQPTKTF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26O4
Molecular weight270.36 g/mol
IUPAC namedipentyl 2-methylidenebutanedioate
InChIKeyNJCKCUVRQPTKTF-UHFFFAOYSA-N
SMILESCCCCCOC(=O)CC(=C)C(=O)OCCCCC

Computed by PubChem (NCBI)