Products 2206608-53-7
CAS 2206608-53-7 is the registry number for 1-[3'-(2-Amino-ethyl)-biphenyl-3-yl]-ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[3-[3-(2-aminoethyl)phenyl]phenyl]ethanol;hydrochloride (CAS 2206608-53-7) is a chemical compound with the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. IUPAC name: 1-[3-[3-(2-aminoethyl)phenyl]phenyl]ethanol;hydrochloride. InChIKey: QXOWIHAXEDUSGZ-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO |
|---|---|
| Molecular weight | 277.79 g/mol |
| IUPAC name | 1-[3-[3-(2-aminoethyl)phenyl]phenyl]ethanol;hydrochloride |
| InChIKey | QXOWIHAXEDUSGZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=C1)C2=CC=CC(=C2)CCN)O.Cl |
Computed by PubChem (NCBI)