Products 881995-46-6
CAS 881995-46-6 appears in our catalog under these names: rac-N-Desmethyl Atomoxetine HCl, Atomoxetine Impurity 31, Desmethyl Atomoxetine Hydrochloride, >95% (HPLC), Desmethyl atomoxetine hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride (CAS 881995-46-6) is a chemical compound with the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. IUPAC name: 3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride. InChIKey: IIBZNZPMFOWXKB-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO |
|---|---|
| Molecular weight | 277.79 g/mol |
| IUPAC name | 3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride |
| InChIKey | IIBZNZPMFOWXKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC(CCN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Desmethyl Atomoxetine Hydrochloride, 3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride, N-Desmethyl Atomoxetine HCl, Atomoxetine impurity 02, ?-(2-Methylphenoxy)benzenepropanamine hydrochloride, 3-phenyl-3-(o-tolyloxy)propan-1-amine hydrochloride, 3-(2-methylphenoxy)-3-phenyl-propan-1-amine;hydrochloride, 3-(2-Methylphenoxy)-3-phenylpropan-1-amine--hydrogen chloride (1/1)