Products 2206609-80-3

CAS 2206609-80-3 is the registry number for 5-Bromo-2-(4-methylsulfanyl-phenoxy)-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-2-(4-methylsulfanylphenoxy)pyridine-3-carboxylate (CAS 2206609-80-3) is a chemical compound with the molecular formula C17H18BrNO3S and a molecular weight of 396.3 g/mol. IUPAC name: tert-butyl 5-bromo-2-(4-methylsulfanylphenoxy)pyridine-3-carboxylate. InChIKey: OHJBOWPSFCLLKX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18BrNO3S
Molecular weight396.3 g/mol
IUPAC nametert-butyl 5-bromo-2-(4-methylsulfanylphenoxy)pyridine-3-carboxylate
InChIKeyOHJBOWPSFCLLKX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)OC2=CC=C(C=C2)SC

Computed by PubChem (NCBI)