CAS 950163-13-0 is the registry number for 3–Bromo–N–cyclopropyl–N–(4–methoxybenzyl)benzenesulfonamide. Offered by: GLPBio. Available pack sizes: 250mg.
3-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 950163-13-0) is a chemical compound with the molecular formula C17H18BrNO3S and a molecular weight of 396.3 g/mol. IUPAC name: 3-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: AWTORWDIMWSGAA-UHFFFAOYSA-N.
| Molecular formula | C17H18BrNO3S |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | 3-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | AWTORWDIMWSGAA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(C2CC2)S(=O)(=O)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)