CAS 220822-23-1 appears in our catalog under these names: 7-Amino-1,6-naphthyridin-2(1h)-one, 95%, 7-Amino-1,6-naphthyridin-2(1H)-one, 97%, 7-Amino-1,6-naphthyridin-2(1H)-one, 95%, 95%, 7-AMINO-1,6-NAPHTHYRIDIN-2(1H)-ONE, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-amino-1H-1,6-naphthyridin-2-one (CAS 220822-23-1) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 7-amino-1H-1,6-naphthyridin-2-one. InChIKey: QRKPBYJUVGZAGC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 7-amino-1H-1,6-naphthyridin-2-one |
| InChIKey | QRKPBYJUVGZAGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=CC(=NC=C21)N |
Computed by PubChem (NCBI)