Products 220897-76-7

CAS 220897-76-7 is the registry number for Pyrazole ether. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-hydroxycarbamate (CAS 220897-76-7) is a chemical compound with the molecular formula C18H16ClN3O4 and a molecular weight of 373.8 g/mol. IUPAC name: methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-hydroxycarbamate. InChIKey: GYSCXYJNCCOQOU-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16ClN3O4
Molecular weight373.8 g/mol
IUPAC namemethyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-hydroxycarbamate
InChIKeyGYSCXYJNCCOQOU-UHFFFAOYSA-N
SMILESCOC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)O

Computed by PubChem (NCBI)