CAS 34197-46-1 is the registry number for 4-Methylumbelliferyl 4-Guanidinobenzoate Hydrochloride. Offered by: TRC. Available pack sizes: 5g.
(4-methyl-2-oxochromen-7-yl) 4-(diaminomethylideneamino)benzoate;hydrochloride (CAS 34197-46-1) is a chemical compound with the molecular formula C18H16ClN3O4 and a molecular weight of 373.8 g/mol. IUPAC name: (4-methyl-2-oxochromen-7-yl) 4-(diaminomethylideneamino)benzoate;hydrochloride. InChIKey: DAFWZROYEOVJAL-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O4 |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | (4-methyl-2-oxochromen-7-yl) 4-(diaminomethylideneamino)benzoate;hydrochloride |
| InChIKey | DAFWZROYEOVJAL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC(=O)C3=CC=C(C=C3)N=C(N)N.Cl |
Computed by PubChem (NCBI)