Products 22090-27-3
CAS 22090-27-3 appears in our catalog under these names: 4–(1–Pyrrolidinyl)benzoic acid, 4-(1-Pyrrolidinyl)benzoic acid, 97% , 4-(1-PYRROLIDINYL)BENZOIC ACID, 97%, 4-(Pyrrolidin-1-yl)benzoic acid, 98%, 98%, 4-Pyrrolidin-1-yl-benzoic acid, 97%. Offered by: GLPBio, Thermo Scientific, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250MG, 10g.
4-pyrrolidin-1-ylbenzoic acid (CAS 22090-27-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 4-pyrrolidin-1-ylbenzoic acid. InChIKey: KPCBFFYRSJPCJH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylbenzoic acid |
| InChIKey | KPCBFFYRSJPCJH-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)