Products 2209087-23-8
CAS 2209087-23-8 is the registry number for 1-(4-Bromophenyl)-3-fluorobicyclo[1.1.1]pentane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-3-fluorobicyclo[1.1.1]pentane (CAS 2209087-23-8) is a chemical compound with the molecular formula C11H10BrF and a molecular weight of 241.10 g/mol. IUPAC name: 1-(4-bromophenyl)-3-fluorobicyclo[1.1.1]pentane. InChIKey: WKYQITXQOTZGOE-UHFFFAOYSA-N.
| Molecular formula | C11H10BrF |
|---|---|
| Molecular weight | 241.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-fluorobicyclo[1.1.1]pentane |
| InChIKey | WKYQITXQOTZGOE-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)F)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)