CAS 2676867-20-0 is the registry number for 3-Bromo-7-fluoro-2,4,5,6-tetrahydro-1H-cyclobuta[f]indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-7-fluorotricyclo[6.3.0.03,6]undeca-1(8),2,6-triene (CAS 2676867-20-0) is a chemical compound with the molecular formula C11H10BrF and a molecular weight of 241.10 g/mol. IUPAC name: 2-bromo-7-fluorotricyclo[6.3.0.03,6]undeca-1(8),2,6-triene. InChIKey: IGMQOASIDUUDHP-UHFFFAOYSA-N.
| Molecular formula | C11H10BrF |
|---|---|
| Molecular weight | 241.10 g/mol |
| IUPAC name | 2-bromo-7-fluorotricyclo[6.3.0.03,6]undeca-1(8),2,6-triene |
| InChIKey | IGMQOASIDUUDHP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C3CCC3=C2F)Br |
Computed by PubChem (NCBI)