CAS 221018-02-6 is the registry number for 4'-(Methylthio)-(1,1'-biphenyl)-4-carbaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-methylsulfanylphenyl)benzaldehyde (CAS 221018-02-6) is a chemical compound with the molecular formula C14H12OS and a molecular weight of 228.31 g/mol. IUPAC name: 4-(4-methylsulfanylphenyl)benzaldehyde. InChIKey: AIQQOUGEPPIVBV-UHFFFAOYSA-N.
| Molecular formula | C14H12OS |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 4-(4-methylsulfanylphenyl)benzaldehyde |
| InChIKey | AIQQOUGEPPIVBV-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)