CAS 6028-89-3 appears in our catalog under these names: 3-(2-Thienyl)-1-(p-tolyl)-prop-2-en-1-one, 95%, 3-(Thiophen-2-yl)-1-(p-tolyl)prop-2-en-1-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 10g.
1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one (CAS 6028-89-3) is a chemical compound with the molecular formula C14H12OS and a molecular weight of 228.31 g/mol. IUPAC name: 1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one. InChIKey: OUDDTWPBSXBJOY-UHFFFAOYSA-N.
| Molecular formula | C14H12OS |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one |
| InChIKey | OUDDTWPBSXBJOY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C=CC2=CC=CS2 |
Computed by PubChem (NCBI)