CAS 22110-53-8 appears in our catalog under these names: 1-Adamantyl isocyanide, 95%, 1–Isocyanoadamantane, 1-Isocyanoadamantane, 1-Isocyanoadamantane, >97.0%(GC), 1-Isocyanoadamantane 97% GC. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 250mg, 500mg, 1000mg, 2000mg, 10g, 100mg.
1-isocyanoadamantane (CAS 22110-53-8) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: 1-isocyanoadamantane. InChIKey: RPRJRJNIFAYHRF-UHFFFAOYSA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | 1-isocyanoadamantane |
| InChIKey | RPRJRJNIFAYHRF-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)