CAS 2211934-51-7 is the registry number for (2-(Phenoxycarbonyl)phenyl)boronic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(2-phenoxycarbonylphenyl)boronic acid (CAS 2211934-51-7) is a chemical compound with the molecular formula C13H11BO4 and a molecular weight of 242.04 g/mol. IUPAC name: (2-phenoxycarbonylphenyl)boronic acid. InChIKey: AUGBWBXAUSLNIT-UHFFFAOYSA-N.
| Molecular formula | C13H11BO4 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | (2-phenoxycarbonylphenyl)boronic acid |
| InChIKey | AUGBWBXAUSLNIT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)OC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)