Products 872341-95-2
CAS 872341-95-2 appears in our catalog under these names: 4'-Borono-[1,1'-biphenyl]-4-carboxylic acid, 95%, 4'-Borono-[1,1'-biphenyl]-4-carboxylic acid, 97%, 4'–Borono–(1，1'–Biphenyl)–4–Carboxylic Acid, 4'-Borono-[1,1'-biphenyl]-4-carboxylic acid 97%, 4'-Borono-[1,1'-biphenyl]-4-carboxylic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 200mg.
4-(4-boronophenyl)benzoic acid (CAS 872341-95-2) is a chemical compound with the molecular formula C13H11BO4 and a molecular weight of 242.04 g/mol. IUPAC name: 4-(4-boronophenyl)benzoic acid. InChIKey: CYHASYNKKTWLFZ-UHFFFAOYSA-N.
| Molecular formula | C13H11BO4 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 4-(4-boronophenyl)benzoic acid |
| InChIKey | CYHASYNKKTWLFZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O)(O)O |
Computed by PubChem (NCBI)