CAS 221241-25-4 is the registry number for 2,5-Dibromo-4-nitropyridin-1-ium-1-olate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,5-dibromo-4-nitro-1-oxidopyridin-1-ium (CAS 221241-25-4) is a chemical compound with the molecular formula C5H2Br2N2O3 and a molecular weight of 297.89 g/mol. IUPAC name: 2,5-dibromo-4-nitro-1-oxidopyridin-1-ium. InChIKey: WBVMRZUZKQBXGD-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O3 |
|---|---|
| Molecular weight | 297.89 g/mol |
| IUPAC name | 2,5-dibromo-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | WBVMRZUZKQBXGD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C[N+](=C1Br)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)