CAS 98027-81-7 appears in our catalog under these names: 2,6-Dibromo-4-nitropyridine 1-oxide, Pyridine, 2,6-dibromo-4-nitro-, 1-oxide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 5g.
2,6-dibromo-4-nitro-1-oxidopyridin-1-ium (CAS 98027-81-7) is a chemical compound with the molecular formula C5H2Br2N2O3 and a molecular weight of 297.89 g/mol. IUPAC name: 2,6-dibromo-4-nitro-1-oxidopyridin-1-ium. InChIKey: MJEDSUKRJRIBKE-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O3 |
|---|---|
| Molecular weight | 297.89 g/mol |
| IUPAC name | 2,6-dibromo-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | MJEDSUKRJRIBKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C([N+](=C1Br)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)