CAS 22132-99-6 appears in our catalog under these names: S-Methyl-s-(4-chlorophenyl) sulfoximine, 95%, S-Methyl-S-(4-chlorophenyl) sulfoximine, 95-<97%, S-Methyl-S-(4-chlorophenyl) sulfoximine, ≥97-<99%, S-Methyl-S-(4-chlorophenyl) sulfoximine, S-Methyl-S-(4-chlorophenyl) sulfoximine 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 2,5g, 25g, 0,5g.
(4-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane (CAS 22132-99-6) is a chemical compound with the molecular formula C7H8ClNOS and a molecular weight of 189.66 g/mol. IUPAC name: (4-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: XSKJSJPUIQNRSQ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNOS |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (4-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | XSKJSJPUIQNRSQ-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)