CAS 22133-00-2 appears in our catalog under these names: (3-Chlorophenyl)(imino)(methyl)-l6-sulfanone, 95%, S-​(3-​Chlorophenyl)​-​S-​methyl-sulfoximine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane (CAS 22133-00-2) is a chemical compound with the molecular formula C7H8ClNOS and a molecular weight of 189.66 g/mol. IUPAC name: (3-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: QULXQZIRHOOTOZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNOS |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (3-chlorophenyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | QULXQZIRHOOTOZ-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)