CAS 2213398-75-3 appears in our catalog under these names: Ibrutinib Impurity 15, Ibrutinib Impurity 8, Ibrutinib Impurity 28, 1-Methyl-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 98%, 98%, Ibrutinib impurity 28, 98.99%. Offered by: Chemat Brand, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 10mg, 100mg, 50 mg, 25 mg, 100 mg, 10 mg.
1-methyl-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 2213398-75-3) is a chemical compound with the molecular formula C18H15N5O and a molecular weight of 317.3 g/mol. IUPAC name: 1-methyl-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: GMSABXWDTDDUPQ-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 1-methyl-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | GMSABXWDTDDUPQ-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=NC(=C2C(=N1)C3=CC=C(C=C3)OC4=CC=CC=C4)N |
Computed by PubChem (NCBI)