CAS 710945-68-9 is the registry number for N-(1H-Indol-5-yl)-5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1H-indol-5-yl)-5-methyl-2-phenyltriazole-4-carboxamide (CAS 710945-68-9) is a chemical compound with the molecular formula C18H15N5O and a molecular weight of 317.3 g/mol. IUPAC name: N-(1H-indol-5-yl)-5-methyl-2-phenyltriazole-4-carboxamide. InChIKey: HQDXPMZHUWUMTA-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | N-(1H-indol-5-yl)-5-methyl-2-phenyltriazole-4-carboxamide |
| InChIKey | HQDXPMZHUWUMTA-UHFFFAOYSA-N |
| SMILES | CC1=NN(N=C1C(=O)NC2=CC3=C(C=C2)NC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)