Products 22138-73-4
CAS 22138-73-4 appears in our catalog under these names: 3–(4–Fluorophenyl)–2–methylpropanoic acid, 4-Fluoro-alpha-methyl-benzenepropanic acid, 3-(4-Fluorophenyl)-2-methylpropanoic acid, 95%, 3-(4-Fluorophenyl)-2-methylpropanoic acid 95%, 3-(4-Fluorophenyl)-2-methylpropanoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 20kg, 10g, 5g, 25g, 100g.
3-(4-fluorophenyl)-2-methylpropanoic acid (CAS 22138-73-4) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 3-(4-fluorophenyl)-2-methylpropanoic acid. InChIKey: KPWBMCKJLTZFFT-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | KPWBMCKJLTZFFT-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-fluorophenyl)-2-methylpropanoic acid, 4-Fluoro-alpha-methyl-benzenepropanic acid, p-fluoro-alpha-methylhydrocinnamic acid, 3-(4-Fluorophenyl)-2-methylpropionic acid, Sulindac Impurity 2, p-fluorobenzylpropionic acid, KPWBMCKJLTZFFT-UHFFFAOYSA-N, rho-fluoro-a-methylhydrocinnamic acid, p -fluoro-alpha-methylhydrocinnamic acid, p-fluoro-alpha-methylhydrocinnarnic acid