Products 221446-00-0

CAS 221446-00-0 appears in our catalog under these names: 3-Oxo-2,3-dihydrobenzo(d)isothiazole-5-carboxylic acid 1,1-dioxide, 97%, 1,1,3-Trioxo-2,3-dihydro-1,2-benzothiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,1,3-trioxo-1,2-benzothiazole-5-carboxylic acid (CAS 221446-00-0) is a chemical compound with the molecular formula C8H5NO5S and a molecular weight of 227.20 g/mol. IUPAC name: 1,1,3-trioxo-1,2-benzothiazole-5-carboxylic acid. InChIKey: JNAXNQWQGXRBTE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO5S
Molecular weight227.20 g/mol
IUPAC name1,1,3-trioxo-1,2-benzothiazole-5-carboxylic acid
InChIKeyJNAXNQWQGXRBTE-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)C(=O)NS2(=O)=O

Computed by PubChem (NCBI)