CAS 90779-46-7 appears in our catalog under these names: 3-Oxo-2,3-dihydro-1,2-benzisothiazole-6-carboxylic acid 1,1-dioxide, 95%, 3-Oxo-2,3-dihydrobenzo(d)isothiazole-6-carboxylic acid 1,1-dioxide, 95+%, 1,1,3-Trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (CAS 90779-46-7) is a chemical compound with the molecular formula C8H5NO5S and a molecular weight of 227.20 g/mol. IUPAC name: 1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid. InChIKey: DVKWMYALCCTNKN-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5S |
|---|---|
| Molecular weight | 227.20 g/mol |
| IUPAC name | 1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| InChIKey | DVKWMYALCCTNKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)