CAS 2215-21-6 appears in our catalog under these names: 3,5-Diisopropylsalicylic acid, 95%, Propofol Impurity 2, 3,5-Diisopropylsalicylic Acid, 2-Hydroxy-3,5-diisopropylbenzoic acid 95%, 3,5-DIISOPROPYLSALICYLIC ACID, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, on request, 500mg, 250g, 500g.
2-hydroxy-3,5-di(propan-2-yl)benzoic acid (CAS 2215-21-6) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 2-hydroxy-3,5-di(propan-2-yl)benzoic acid. InChIKey: XUFUYOGWFZSHGE-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 2-hydroxy-3,5-di(propan-2-yl)benzoic acid |
| InChIKey | XUFUYOGWFZSHGE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(=O)O)O)C(C)C |
Computed by PubChem (NCBI)