CAS 532987-19-2 appears in our catalog under these names: (R)–2–Amino–2–(3–methoxyphenyl)ethanol hydrochloride, (R)-2-Amino-2-(3-methoxyphenyl)ethanol hydrochloride, 98%, (2R)-2-Amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride, (2R)-2-Amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride, 95%, (2R)-2-amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride, 98%, 98%. Offered by: GLPBio, Fluorochem, Biosynth, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g.
(2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride (CAS 532987-19-2) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: (2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride. InChIKey: CHLMFPQGTHFLAT-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | CHLMFPQGTHFLAT-FVGYRXGTSA-N |
| SMILES | COC1=CC=CC(=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)