CAS 2217-77-8 appears in our catalog under these names: Biphenyl-4-yl-hydrazine, 95%, (1,1'-Biphenyl)-4-ylhydrazine, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
(4-phenylphenyl)hydrazine (CAS 2217-77-8) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: (4-phenylphenyl)hydrazine. InChIKey: UQPKIBHPQJMLMI-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (4-phenylphenyl)hydrazine |
| InChIKey | UQPKIBHPQJMLMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NN |
Computed by PubChem (NCBI)