CAS 22179-74-4 appears in our catalog under these names: 3,5-Dichlorothiobenzamide, 95%, 3,5-Dichlorothiobenzamide, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
3,5-dichlorobenzenecarbothioamide (CAS 22179-74-4) is a chemical compound with the molecular formula C7H5Cl2NS and a molecular weight of 206.09 g/mol. IUPAC name: 3,5-dichlorobenzenecarbothioamide. InChIKey: DQYCYBQFAAOJAR-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NS |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | 3,5-dichlorobenzenecarbothioamide |
| InChIKey | DQYCYBQFAAOJAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=S)N |
Computed by PubChem (NCBI)