CAS 69622-81-7 is the registry number for 2,5-Dichlorothiobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,5-dichlorobenzenecarbothioamide (CAS 69622-81-7) is a chemical compound with the molecular formula C7H5Cl2NS and a molecular weight of 206.09 g/mol. IUPAC name: 2,5-dichlorobenzenecarbothioamide. InChIKey: YQORNGRDGWVQOD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NS |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | 2,5-dichlorobenzenecarbothioamide |
| InChIKey | YQORNGRDGWVQOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=S)N)Cl |
Computed by PubChem (NCBI)