CAS 2218436-87-2 appears in our catalog under these names: (1S,3S,6R)-7,7-Difluorobicyclo[4.1.0]heptan-3-amine hydrochloride, 97%, 97%, (1S,3S,6R)-7,7-Difluorobicyclo[4.1.0]heptan-3-amine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S,3S,6R)-7,7-difluorobicyclo[4.1.0]heptan-3-amine;hydrochloride (CAS 2218436-87-2) is a chemical compound with the molecular formula C7H12ClF2N and a molecular weight of 183.63 g/mol. IUPAC name: (1S,3S,6R)-7,7-difluorobicyclo[4.1.0]heptan-3-amine;hydrochloride. InChIKey: SWFSQWGRQBBYBA-YAFCINRGSA-N.
| Molecular formula | C7H12ClF2N |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (1S,3S,6R)-7,7-difluorobicyclo[4.1.0]heptan-3-amine;hydrochloride |
| InChIKey | SWFSQWGRQBBYBA-YAFCINRGSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2(F)F)C[C@H]1N.Cl |
Computed by PubChem (NCBI)