Products 2218487-28-4

CAS 2218487-28-4 is the registry number for Erlotinib Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethoxy]acetic acid (CAS 2218487-28-4) is a chemical compound with the molecular formula C22H21N3O6 and a molecular weight of 423.4 g/mol. IUPAC name: 2-[2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethoxy]acetic acid. InChIKey: DGMHDWUKQVSZAO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21N3O6
Molecular weight423.4 g/mol
IUPAC name2-[2-[4-(3-ethynylanilino)-7-(2-hydroxyethoxy)quinazolin-6-yl]oxyethoxy]acetic acid
InChIKeyDGMHDWUKQVSZAO-UHFFFAOYSA-N
SMILESC#CC1=CC(=CC=C1)NC2=NC=NC3=CC(=C(C=C32)OCCOCC(=O)O)OCCO

Computed by PubChem (NCBI)