CAS 35016-67-2 appears in our catalog under these names: Z-His(z)-oh, 95%, N-alpha-Nim-Bis-Z-L-histidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 25g.
(2S)-2-(phenylmethoxycarbonylamino)-3-(1-phenylmethoxycarbonylimidazol-4-yl)propanoic acid (CAS 35016-67-2) is a chemical compound with the molecular formula C22H21N3O6 and a molecular weight of 423.4 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-(1-phenylmethoxycarbonylimidazol-4-yl)propanoic acid. InChIKey: FGLXUCKEBNGNEL-IBGZPJMESA-N.
| Molecular formula | C22H21N3O6 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-3-(1-phenylmethoxycarbonylimidazol-4-yl)propanoic acid |
| InChIKey | FGLXUCKEBNGNEL-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CN(C=N2)C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)