Products 2219353-41-8
CAS 2219353-41-8 is the registry number for 4-tert-Butyl-2-((2R)-pyrrolidin-2-yl)-1,3-oxazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-tert-butyl-2-[(2R)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride (CAS 2219353-41-8) is a chemical compound with the molecular formula C11H20Cl2N2O and a molecular weight of 267.19 g/mol. IUPAC name: 4-tert-butyl-2-[(2R)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride. InChIKey: IUZXTWRTZDWLQQ-YCBDHFTFSA-N.
| Molecular formula | C11H20Cl2N2O |
|---|---|
| Molecular weight | 267.19 g/mol |
| IUPAC name | 4-tert-butyl-2-[(2R)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride |
| InChIKey | IUZXTWRTZDWLQQ-YCBDHFTFSA-N |
| SMILES | CC(C)(C)C1=COC(=N1)[C@H]2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)