CAS 2219353-79-2 is the registry number for rac-(4R,6R)-1-((tert-Butoxy)carbonyl)-1-azaspiro(3.3)heptane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(2-methylpropan-2-yl)oxycarbonyl]-1-azaspiro[3.3]heptane-6-carboxylic acid (CAS 2219353-79-2) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-1-azaspiro[3.3]heptane-6-carboxylic acid. InChIKey: PLTMDLGZYGFWOV-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-1-azaspiro[3.3]heptane-6-carboxylic acid |
| InChIKey | PLTMDLGZYGFWOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CC(C2)C(=O)O |
Computed by PubChem (NCBI)