Products 2219354-06-8
CAS 2219354-06-8 is the registry number for 2-((6S)-5-{((9H-Fluoren-9-yl)methoxy)carbonyl}-5-azaspiro(2.4)heptan-6-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(6S)-5-(9H-fluoren-9-ylmethoxycarbonyl)-5-azaspiro[2.4]heptan-6-yl]acetic acid (CAS 2219354-06-8) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-[(6S)-5-(9H-fluoren-9-ylmethoxycarbonyl)-5-azaspiro[2.4]heptan-6-yl]acetic acid. InChIKey: YCVKSFZEBAHDHL-OAHLLOKOSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-[(6S)-5-(9H-fluoren-9-ylmethoxycarbonyl)-5-azaspiro[2.4]heptan-6-yl]acetic acid |
| InChIKey | YCVKSFZEBAHDHL-OAHLLOKOSA-N |
| SMILES | C1CC12C[C@H](N(C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)CC(=O)O |
Computed by PubChem (NCBI)