Products 2219370-84-8

CAS 2219370-84-8 is the registry number for rac-tert-Butyl N-((1R,2R)-2-hydroxycycloheptyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate (CAS 2219370-84-8) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate. InChIKey: FXVLUNMZSAJYNE-NXEZZACHSA-N.

Identity
Molecular formulaC12H23NO3
Molecular weight229.32 g/mol
IUPAC nametert-butyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate
InChIKeyFXVLUNMZSAJYNE-NXEZZACHSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1CCCCC[C@H]1O

Computed by PubChem (NCBI)