Products 2219371-51-2

CAS 2219371-51-2 is the registry number for tert-Butyl N-{8-oxa-1-azaspiro(4.5)decan-3-yl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(8-oxa-1-azaspiro[4.5]decan-3-yl)carbamate (CAS 2219371-51-2) is a chemical compound with the molecular formula C13H24N2O3 and a molecular weight of 256.34 g/mol. IUPAC name: tert-butyl N-(8-oxa-1-azaspiro[4.5]decan-3-yl)carbamate. InChIKey: NTVMDPWQPMIUAO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24N2O3
Molecular weight256.34 g/mol
IUPAC nametert-butyl N-(8-oxa-1-azaspiro[4.5]decan-3-yl)carbamate
InChIKeyNTVMDPWQPMIUAO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC2(CCOCC2)NC1

Computed by PubChem (NCBI)