Products 2219380-15-9
CAS 2219380-15-9 is the registry number for tert-Butyl 3-(4-amino-6-hydroxypyrimidin-2-yl)azetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-(4-amino-6-oxo-1H-pyrimidin-2-yl)azetidine-1-carboxylate (CAS 2219380-15-9) is a chemical compound with the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. IUPAC name: tert-butyl 3-(4-amino-6-oxo-1H-pyrimidin-2-yl)azetidine-1-carboxylate. InChIKey: DUGCAQNTXZQFGN-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O3 |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | tert-butyl 3-(4-amino-6-oxo-1H-pyrimidin-2-yl)azetidine-1-carboxylate |
| InChIKey | DUGCAQNTXZQFGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=NC(=CC(=O)N2)N |
Computed by PubChem (NCBI)