Products 6184-11-8
CAS 6184-11-8 is the registry number for Lysine 4-nitroanilide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide (CAS 6184-11-8) is a chemical compound with the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. IUPAC name: (2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide. InChIKey: VUUNELJIFNFWJC-NSHDSACASA-N.
| Molecular formula | C12H18N4O3 |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-(4-nitrophenyl)hexanamide |
| InChIKey | VUUNELJIFNFWJC-NSHDSACASA-N |
| SMILES | C1=CC(=CC=C1NC(=O)[C@H](CCCCN)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)